C19H29FN2O3 — CID 113242207
tert-butyl N-[[2-(4-fluoro-2-methoxyanilino)cyclohexyl]methyl]carbamate (PubChem CID 113242207) has the molecular formula C19H29FN2O3 and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl N-[[2-(4-fluoro-2-methoxyanilino)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4-fluoro-2-methoxyanilino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 113242207 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-[[2-(4-fluoro-2-methoxyanilino)cyclohexyl]methyl]carbamate |
| SMILES | COc1cc(F)ccc1NC1CCCCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29FN2O3/c1-19(2,3)25-18(23)21-12-13-7-5-6-8-15(13)22-16-10-9-14(20)11-17(16)24-4/h9-11,13,15,22H,5-8,12H2,1-4H3,(H,21,23) |
| InChIKey | DRUCXJSZYBWRBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |