C10H11N3O2S2 — CID 103698000
6-cyano-N-(thiolan-3-yl)pyridine-3-sulfonamide (PubChem CID 103698000) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 6-cyano-N-(thiolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(thiolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103698000 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 6-cyano-N-(thiolan-3-yl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC2CCSC2)cn1 |
| InChI | InChI=1S/C10H11N3O2S2/c11-5-8-1-2-10(6-12-8)17(14,15)13-9-3-4-16-7-9/h1-2,6,9,13H,3-4,7H2 |
| InChIKey | DNMCLJNFANIOJL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |