C8H11N3S2 — CID 103703361
3-methyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 103703361) has the molecular formula C8H11N3S2 and a molecular weight of 213.33 g/mol. Its IUPAC name is 3-methyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-methyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103703361 |
| Molecular Formula | C8H11N3S2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 3-methyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | C#CCSCCNc1nc(C)ns1 |
| InChI | InChI=1S/C8H11N3S2/c1-3-5-12-6-4-9-8-10-7(2)11-13-8/h1H,4-6H2,2H3,(H,9,10,11) |
| InChIKey | FJLUHNNMLQCXSL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|