C12H15N3O — CID 103703733
2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carbonitrile (PubChem CID 103703733) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103703733 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-[[2-(hydroxymethyl)cyclopentyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NC1CCCC1CO |
| InChI | InChI=1S/C12H15N3O/c13-7-9-4-2-6-14-12(9)15-11-5-1-3-10(11)8-16/h2,4,6,10-11,16H,1,3,5,8H2,(H,14,15) |
| InChIKey | PYKOZPPAJLWNMY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |