About 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol
3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol (PubChem CID 103705992) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol.
Molecular Properties
| Compound Name | 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol |
| PubChem CID | 103705992 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol |
| SMILES | Cc1cc(CSC(C)C(C)O)on1 |
| InChI | InChI=1S/C9H15NO2S/c1-6-4-9(12-10-6)5-13-8(3)7(2)11/h4,7-8,11H,5H2,1-3H3 |
| InChIKey | NOXRAKFLQJBWCA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol?
The IUPAC name of 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol (CID 103705992) is 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol.
What is the SMILES notation for 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol?
The canonical SMILES for 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol is Cc1cc(CSC(C)C(C)O)on1.
What is the InChIKey of 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol?
The InChIKey is NOXRAKFLQJBWCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S/c1-6-4-9(12-10-6)5-13-8(3)7(2)11/h4,7-8,11H,5H2,1-3H3.
What are the key properties of 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol?
3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol has a molecular weight of 201.29 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]butan-2-ol is sourced from PubChem (CID 103705992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).