C9H15NO — CID 89112070
3-methyl-5-(2-methylbutyl)-1,2-oxazole (PubChem CID 89112070) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 3-methyl-5-(2-methylbutyl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(2-methylbutyl)-1,2-oxazole |
|---|---|
| PubChem CID | 89112070 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 3-methyl-5-(2-methylbutyl)-1,2-oxazole |
| SMILES | CCC(C)Cc1cc(C)no1 |
| InChI | InChI=1S/C9H15NO/c1-4-7(2)5-9-6-8(3)10-11-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | MEHABOTVLGVJRY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |