C10H18N2O — CID 167047354
(2S)-4-methyl-1-(3-methyl-1,2-oxazol-5-yl)pentan-2-amine (PubChem CID 167047354) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (2S)-4-methyl-1-(3-methyl-1,2-oxazol-5-yl)pentan-2-amine.
| Compound Name | (2S)-4-methyl-1-(3-methyl-1,2-oxazol-5-yl)pentan-2-amine |
|---|---|
| PubChem CID | 167047354 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (2S)-4-methyl-1-(3-methyl-1,2-oxazol-5-yl)pentan-2-amine |
| SMILES | Cc1cc(C[C@@H](N)CC(C)C)on1 |
| InChI | InChI=1S/C10H18N2O/c1-7(2)4-9(11)6-10-5-8(3)12-13-10/h5,7,9H,4,6,11H2,1-3H3/t9-/m0/s1 |
| InChIKey | KSBNJMQMLOVXOL-VIFPVBQESA-N |
| XLogP | 1.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |