C24H22ClO6PS3 — CID 10370767
(4-methoxycarbonyl-5-methylsulfanyl-1,3-dithiol-2-yl)-triphenylphosphanium perchlorate (PubChem CID 10370767) has the molecular formula C24H22ClO6PS3 and a molecular weight of 569.06 g/mol. Its IUPAC name is (4-methoxycarbonyl-5-methylsulfanyl-1,3-dithiol-2-yl)-triphenylphosphanium perchlorate.
| Compound Name | (4-methoxycarbonyl-5-methylsulfanyl-1,3-dithiol-2-yl)-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 10370767 |
| Molecular Formula | C24H22ClO6PS3 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | (4-methoxycarbonyl-5-methylsulfanyl-1,3-dithiol-2-yl)-triphenylphosphanium perchlorate |
| SMILES | COC(=O)C1=C(SC)SC([P+](c2ccccc2)(c2ccccc2)c2ccccc2)S1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H22O2PS3.ClHO4/c1-26-22(25)21-23(28-2)30-24(29-21)27(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;2-1(3,4)5/h3-17,24H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IUKBUASKEFTDNE-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|