C20H19NO6S2 — CID 10836541
trimethyl 4-methylsulfanyl-12bH-[1,4]thiazepino[5,4-a]isoquinoline-1,2,5-tricarboxylate (PubChem CID 10836541) has the molecular formula C20H19NO6S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is trimethyl 4-methylsulfanyl-12bH-[1,4]thiazepino[5,4-a]isoquinoline-1,2,5-tricarboxylate.
| Compound Name | trimethyl 4-methylsulfanyl-12bH-[1,4]thiazepino[5,4-a]isoquinoline-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 10836541 |
| Molecular Formula | C20H19NO6S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | trimethyl 4-methylsulfanyl-12bH-[1,4]thiazepino[5,4-a]isoquinoline-1,2,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3ccccc3C=CN2C(C(=O)OC)=C(SC)S1 |
| InChI | InChI=1S/C20H19NO6S2/c1-25-17(22)13-14-12-8-6-5-7-11(12)9-10-21(14)15(18(23)26-2)20(28-4)29-16(13)19(24)27-3/h5-10,14H,1-4H3 |
| InChIKey | CJTBEKTWILKHEL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|