C12H11Cl2N3OS — CID 103709249
3,6-dichloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 103709249) has the molecular formula C12H11Cl2N3OS and a molecular weight of 316.21 g/mol. Its IUPAC name is 3,6-dichloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103709249 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 3,6-dichloro-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | CCc1cnc(CNC(=O)c2nc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C12H11Cl2N3OS/c1-2-7-5-15-10(19-7)6-16-12(18)11-8(13)3-4-9(14)17-11/h3-5H,2,6H2,1H3,(H,16,18) |
| InChIKey | CNUXMMAIOOWWGK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|