C16H25NO3S — CID 103712176
N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-phenylsulfanylbutanamide (PubChem CID 103712176) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 103712176 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)-4-phenylsulfanylbutanamide |
| SMILES | COCCC(C)(O)CNC(=O)CCCSc1ccccc1 |
| InChI | InChI=1S/C16H25NO3S/c1-16(19,10-11-20-2)13-17-15(18)9-6-12-21-14-7-4-3-5-8-14/h3-5,7-8,19H,6,9-13H2,1-2H3,(H,17,18) |
| InChIKey | WMASLGFVUZFHHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|