C15H19N3O2 — CID 103713237
N-(2-hydroxy-2-methylpentyl)quinoxaline-6-carboxamide (PubChem CID 103713237) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpentyl)quinoxaline-6-carboxamide.
| Compound Name | N-(2-hydroxy-2-methylpentyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 103713237 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-hydroxy-2-methylpentyl)quinoxaline-6-carboxamide |
| SMILES | CCCC(C)(O)CNC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-6-15(2,20)10-18-14(19)11-4-5-12-13(9-11)17-8-7-16-12/h4-5,7-9,20H,3,6,10H2,1-2H3,(H,18,19) |
| InChIKey | UMAWPDJAEAVIAA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |