C13H17Cl2NO2 — CID 113240344
3,4-dichloro-N-(2-hydroxy-2-methylpentyl)benzamide (PubChem CID 113240344) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-hydroxy-2-methylpentyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-hydroxy-2-methylpentyl)benzamide |
|---|---|
| PubChem CID | 113240344 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3,4-dichloro-N-(2-hydroxy-2-methylpentyl)benzamide |
| SMILES | CCCC(C)(O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-3-6-13(2,18)8-16-12(17)9-4-5-10(14)11(15)7-9/h4-5,7,18H,3,6,8H2,1-2H3,(H,16,17) |
| InChIKey | ZWJMLNYLNUJAQW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |