C12H15Cl2NO3 — CID 90500989
3,4-dichloro-N-(2-hydroxy-3-methoxy-2-methylpropyl)benzamide (PubChem CID 90500989) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-hydroxy-3-methoxy-2-methylpropyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-hydroxy-3-methoxy-2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 90500989 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3,4-dichloro-N-(2-hydroxy-3-methoxy-2-methylpropyl)benzamide |
| SMILES | COCC(C)(O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3/c1-12(17,7-18-2)6-15-11(16)8-3-4-9(13)10(14)5-8/h3-5,17H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | JNDGOSDVWQNCLQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |