C13H18N2O4 — CID 122055666
2-[(2-hydroxy-2-methylpentyl)carbamoyl]pyridine-4-carboxylic acid (PubChem CID 122055666) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-methylpentyl)carbamoyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(2-hydroxy-2-methylpentyl)carbamoyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 122055666 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[(2-hydroxy-2-methylpentyl)carbamoyl]pyridine-4-carboxylic acid |
| SMILES | CCCC(C)(O)CNC(=O)c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C13H18N2O4/c1-3-5-13(2,19)8-15-11(16)10-7-9(12(17)18)4-6-14-10/h4,6-7,19H,3,5,8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | RJCSSWRCXOVGNM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |