C10H19NO5S — CID 103719047
N-(1,1-dioxothian-4-yl)-2-(2-methoxyethoxy)acetamide (PubChem CID 103719047) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 103719047 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H19NO5S/c1-15-4-5-16-8-10(12)11-9-2-6-17(13,14)7-3-9/h9H,2-8H2,1H3,(H,11,12) |
| InChIKey | XYELADVVCJOQSZ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|