C12H21ClN2O4 — CID 108562763
N-[1-(2-chloroacetyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108562763) has the molecular formula C12H21ClN2O4 and a molecular weight of 292.76 g/mol. Its IUPAC name is N-[1-(2-chloroacetyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[1-(2-chloroacetyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108562763 |
| Molecular Formula | C12H21ClN2O4 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[1-(2-chloroacetyl)piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC1CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C12H21ClN2O4/c1-18-6-7-19-9-11(16)14-10-2-4-15(5-3-10)12(17)8-13/h10H,2-9H2,1H3,(H,14,16) |
| InChIKey | JNPJXIWTAMDKGT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|