C12H10Cl2N2O2S — CID 103720421
(2-methyl-1,3-thiazol-4-yl)methyl 5-amino-2,3-dichlorobenzoate (PubChem CID 103720421) has the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.20 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 5-amino-2,3-dichlorobenzoate.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 5-amino-2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 103720421 |
| Molecular Formula | C12H10Cl2N2O2S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 5-amino-2,3-dichlorobenzoate |
| SMILES | Cc1nc(COC(=O)c2cc(N)cc(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C12H10Cl2N2O2S/c1-6-16-8(5-19-6)4-18-12(17)9-2-7(15)3-10(13)11(9)14/h2-3,5H,4,15H2,1H3 |
| InChIKey | KLVKOUGSJCEHNB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|