C14H12Cl2N2O2 — CID 103897833
(3-methyl-2-pyridinyl)methyl 5-amino-2,3-dichlorobenzoate (PubChem CID 103897833) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is (3-methyl-2-pyridinyl)methyl 5-amino-2,3-dichlorobenzoate.
| Compound Name | (3-methyl-2-pyridinyl)methyl 5-amino-2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 103897833 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (3-methyl-2-pyridinyl)methyl 5-amino-2,3-dichlorobenzoate |
| SMILES | Cc1cccnc1COC(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl2N2O2/c1-8-3-2-4-18-12(8)7-20-14(19)10-5-9(17)6-11(15)13(10)16/h2-6H,7,17H2,1H3 |
| InChIKey | APODYHXPYHJPBR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|