C13H14N2O2S — CID 64982506
(2-methyl-1,3-thiazol-4-yl)methyl 4-amino-2-methylbenzoate (PubChem CID 64982506) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-2-methylbenzoate.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 64982506 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 4-amino-2-methylbenzoate |
| SMILES | Cc1nc(COC(=O)c2ccc(N)cc2C)cs1 |
| InChI | InChI=1S/C13H14N2O2S/c1-8-5-10(14)3-4-12(8)13(16)17-6-11-7-18-9(2)15-11/h3-5,7H,6,14H2,1-2H3 |
| InChIKey | XMWIOUAHFPNHIX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|