About bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+)
bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) (PubChem CID 10372141) has the molecular formula C18H8Cl2I2MnN2O2
and a molecular weight of 655.93 g/mol. Its IUPAC name is bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+).
Molecular Properties
| Compound Name | bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) |
| PubChem CID | 10372141 |
| Molecular Formula | C18H8Cl2I2MnN2O2 |
| Molecular Weight | 655.93 g/mol |
| Exact Mass | 654.75 |
| IUPAC Name | bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) |
| SMILES | [Mn+2].[O-]c1c([123I])cc(Cl)c2cccnc12.[O-]c1c([123I])cc(Cl)c2cccnc12 |
| InChI | InChI=1S/2C9H5ClINO.Mn/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h2*1-4,13H;/q;;+2/p-2/i2*11-4; |
| InChIKey | FXZPQBMFUHTAEW-OJQMSSNCSA-L |
| XLogP | 5.13 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.93 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+)?
The IUPAC name of bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) (CID 10372141) is bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+).
What is the SMILES notation for bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+)?
The canonical SMILES for bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) is [Mn+2].[O-]c1c([123I])cc(Cl)c2cccnc12.[O-]c1c([123I])cc(Cl)c2cccnc12.
What is the InChIKey of bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+)?
The InChIKey is FXZPQBMFUHTAEW-OJQMSSNCSA-L. The full InChI is InChI=1S/2C9H5ClINO.Mn/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h2*1-4,13H;/q;;+2/p-2/i2*11-4;.
What are the key properties of bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+)?
bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) has a molecular weight of 655.93 g/mol, XLogP of 5.13, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-chloro-7-(123I)iodoquinolin-8-olate);manganese(2+) is sourced from PubChem (CID 10372141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).