C11H20N2S2 — CID 103727711
1-cyclopropyl-3-(2-ethylsulfanylcyclopentyl)thiourea (PubChem CID 103727711) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-ethylsulfanylcyclopentyl)thiourea.
| Compound Name | 1-cyclopropyl-3-(2-ethylsulfanylcyclopentyl)thiourea |
|---|---|
| PubChem CID | 103727711 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-cyclopropyl-3-(2-ethylsulfanylcyclopentyl)thiourea |
| SMILES | CCSC1CCCC1NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H20N2S2/c1-2-15-10-5-3-4-9(10)13-11(14)12-8-6-7-8/h8-10H,2-7H2,1H3,(H2,12,13,14) |
| InChIKey | MHZIPSMSAYPFFJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|