C14H19NO3 — CID 103727932
2,4-dihydroxy-N-(2,2,3,3-tetramethylcyclopropyl)benzamide (PubChem CID 103727932) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(2,2,3,3-tetramethylcyclopropyl)benzamide.
| Compound Name | 2,4-dihydroxy-N-(2,2,3,3-tetramethylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 103727932 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2,4-dihydroxy-N-(2,2,3,3-tetramethylcyclopropyl)benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(O)cc2O)C1(C)C |
| InChI | InChI=1S/C14H19NO3/c1-13(2)12(14(13,3)4)15-11(18)9-6-5-8(16)7-10(9)17/h5-7,12,16-17H,1-4H3,(H,15,18) |
| InChIKey | AYMJCGITQKDIDU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |