C13H15NO4 — CID 107722193
2,4-dihydroxy-N-(4-oxocyclohexyl)benzamide (PubChem CID 107722193) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(4-oxocyclohexyl)benzamide.
| Compound Name | 2,4-dihydroxy-N-(4-oxocyclohexyl)benzamide |
|---|---|
| PubChem CID | 107722193 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2,4-dihydroxy-N-(4-oxocyclohexyl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C13H15NO4/c15-9-3-1-8(2-4-9)14-13(18)11-6-5-10(16)7-12(11)17/h5-8,16-17H,1-4H2,(H,14,18) |
| InChIKey | ACOQSMJTLQWVBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |