C39H28Cl4O8 — CID 10372994
[3-(2,6-dichlorobenzoyl)oxy-5-[(2S,3S)-5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]phenyl] 2,6-dichlorobenzoate (PubChem CID 10372994) has the molecular formula C39H28Cl4O8 and a molecular weight of 766.46 g/mol. Its IUPAC name is [3-(2,6-dichlorobenzoyl)oxy-5-[(2S,3S)-5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]phenyl] 2,6-dichlorobenzoate.
| Compound Name | [3-(2,6-dichlorobenzoyl)oxy-5-[(2S,3S)-5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]phenyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 10372994 |
| Molecular Formula | C39H28Cl4O8 |
| Molecular Weight | 766.46 g/mol |
| Exact Mass | 764.05 |
| IUPAC Name | [3-(2,6-dichlorobenzoyl)oxy-5-[(2S,3S)-5-hydroxy-6-methoxy-2-(4-methoxyphenyl)-4-prop-2-enyl-2,3-dihydro-1-benzofuran-3-yl]phenyl] 2,6-dichlorobenzoate |
| SMILES | C=CCc1c(O)c(OC)cc2c1[C@H](c1cc(OC(=O)c3c(Cl)cccc3Cl)cc(OC(=O)c3c(Cl)cccc3Cl)c1)[C@@H](c1ccc(OC)cc1)O2 |
| InChI | InChI=1S/C39H28Cl4O8/c1-4-7-25-33-30(19-31(48-3)36(25)44)51-37(20-12-14-22(47-2)15-13-20)32(33)21-16-23(49-38(45)34-26(40)8-5-9-27(34)41)18-24(17-21)50-39(46)35-28(42)10-6-11-29(35)43/h4-6,8-19,32,37,44H,1,7H2,2-3H3/t32-,37+/m0/s1 |
| InChIKey | OHUUCZLUSMLBNM-NBWQQBAWSA-N |
| XLogP | 10.46 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.46 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|