C9H8F4N2OS — CID 103732219
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732219) has the molecular formula C9H8F4N2OS and a molecular weight of 268.23 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732219 |
| Molecular Formula | C9H8F4N2OS |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1nc2c(s1)CCC2)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F4N2OS/c10-6(11)9(12,13)7(16)15-8-14-4-2-1-3-5(4)17-8/h6H,1-3H2,(H,14,15,16) |
| InChIKey | ZQHLZZVRGIAPDH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|