C9H9F3N2OS — CID 7213224
2,2,2-trifluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 7213224) has the molecular formula C9H9F3N2OS and a molecular weight of 250.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7213224 |
| Molecular Formula | C9H9F3N2OS |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2,2,2-trifluoro-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nc2c(s1)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2OS/c10-9(11,12)7(15)14-8-13-5-3-1-2-4-6(5)16-8/h1-4H2,(H,13,14,15) |
| InChIKey | HPFBSYAJHUFRCR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |