C9H8BrF4NOS — CID 103732331
N-[2-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732331) has the molecular formula C9H8BrF4NOS and a molecular weight of 334.13 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732331 |
| Molecular Formula | C9H8BrF4NOS |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCCc1ccc(Br)s1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8BrF4NOS/c10-6-2-1-5(17-6)3-4-15-8(16)9(13,14)7(11)12/h1-2,7H,3-4H2,(H,15,16) |
| InChIKey | NYGAIQUSHKBZET-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|