C9H13F4NOS — CID 103733806
2,2,3,3-tetrafluoro-N-(thian-4-ylmethyl)propanamide (PubChem CID 103733806) has the molecular formula C9H13F4NOS and a molecular weight of 259.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(thian-4-ylmethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(thian-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 103733806 |
| Molecular Formula | C9H13F4NOS |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(thian-4-ylmethyl)propanamide |
| SMILES | O=C(NCC1CCSCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H13F4NOS/c10-7(11)9(12,13)8(15)14-5-6-1-3-16-4-2-6/h6-7H,1-5H2,(H,14,15) |
| InChIKey | RVPMMTOLVSQLHK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|