About ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate
ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate (PubChem CID 103737124) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate.
Analyze ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate?
The IUPAC name of ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate (CID 103737124) is ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate.
What is the SMILES notation for ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate?
The canonical SMILES for ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate is CCOC(=O)CCC(=O)NCc1ncc(C)o1.
What is the InChIKey of ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate?
The InChIKey is YUUMPZYBOKVIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-3-16-11(15)5-4-9(14)12-7-10-13-6-8(2)17-10/h6H,3-5,7H2,1-2H3,(H,12,14).
What are the key properties of ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate?
ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate has a molecular weight of 240.26 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-methyl-1,3-oxazol-2-yl)methylamino]-4-oxobutanoate is sourced from PubChem (CID 103737124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).