C12H16Cl2N2O3S — CID 103743716
5,6-dichloro-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-sulfonamide (PubChem CID 103743716) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103743716 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5,6-dichloro-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-sulfonamide |
| SMILES | COC1CC(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-12(2)9(5-10(12)19-3)16-20(17,18)7-4-8(13)11(14)15-6-7/h4,6,9-10,16H,5H2,1-3H3 |
| InChIKey | RPNLTEOBOLIQDF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|