About 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine
1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 103743959) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| PubChem CID | 103743959 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | N/C(=N\CCc1ncno1)NC1CCCC1 |
| InChI | InChI=1S/C10H17N5O/c11-10(15-8-3-1-2-4-8)12-6-5-9-13-7-14-16-9/h7-8H,1-6H2,(H3,11,12,15) |
| InChIKey | UYMWRUYIIZGVQA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The IUPAC name of 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (CID 103743959) is 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
What is the SMILES notation for 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The canonical SMILES for 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine is N/C(=N\CCc1ncno1)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
The InChIKey is UYMWRUYIIZGVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O/c11-10(15-8-3-1-2-4-8)12-6-5-9-13-7-14-16-9/h7-8H,1-6H2,(H3,11,12,15).
What are the key properties of 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine?
1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine has a molecular weight of 223.28 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine is sourced from PubChem (CID 103743959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).