C8H11N3O2 — CID 103744070
(E)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]but-2-enamide (PubChem CID 103744070) has the molecular formula C8H11N3O2 and a molecular weight of 181.20 g/mol. Its IUPAC name is (E)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]but-2-enamide.
| Compound Name | (E)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 103744070 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (E)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H11N3O2/c1-2-3-7(12)9-5-4-8-10-6-11-13-8/h2-3,6H,4-5H2,1H3,(H,9,12)/b3-2+ |
| InChIKey | HYFKFQZIWQFLIA-NSCUHMNNSA-N |
| XLogP | 0.30 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|