C17H26N2O3 — CID 103748609
tert-butyl 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]azetidine-1-carboxylate (PubChem CID 103748609) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 103748609 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl 3-[[5-(2-methylcyclopropyl)furan-2-yl]methylamino]azetidine-1-carboxylate |
| SMILES | CC1CC1c1ccc(CNC2CN(C(=O)OC(C)(C)C)C2)o1 |
| InChI | InChI=1S/C17H26N2O3/c1-11-7-14(11)15-6-5-13(21-15)8-18-12-9-19(10-12)16(20)22-17(2,3)4/h5-6,11-12,14,18H,7-10H2,1-4H3 |
| InChIKey | RVVQOHJPRWKQKI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |