C11H18F3NO3 — CID 103751211
N-[2-(hydroxymethyl)cyclopentyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103751211) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)cyclopentyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-(hydroxymethyl)cyclopentyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103751211 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[2-(hydroxymethyl)cyclopentyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NC1CCCC1CO |
| InChI | InChI=1S/C11H18F3NO3/c12-11(13,14)7-18-5-4-10(17)15-9-3-1-2-8(9)6-16/h8-9,16H,1-7H2,(H,15,17) |
| InChIKey | WBBRRGWEBSWHPJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|