C7H9F3N2O3S — CID 103755811
2-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 103755811) has the molecular formula C7H9F3N2O3S and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 103755811 |
| Molecular Formula | C7H9F3N2O3S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-oxo-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NCC(O)C(F)(F)F)CS1 |
| InChI | InChI=1S/C7H9F3N2O3S/c8-7(9,10)4(13)1-11-5(14)3-2-16-6(15)12-3/h3-4,13H,1-2H2,(H,11,14)(H,12,15) |
| InChIKey | SPCYNPPEDPIESZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|