C7H10F2N2O3S — CID 103770387
N-(3,3-difluoro-2-hydroxypropyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 103770387) has the molecular formula C7H10F2N2O3S and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 103770387 |
| Molecular Formula | C7H10F2N2O3S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NCC(O)C(F)F)CS1 |
| InChI | InChI=1S/C7H10F2N2O3S/c8-5(9)4(12)1-10-6(13)3-2-15-7(14)11-3/h3-5,12H,1-2H2,(H,10,13)(H,11,14) |
| InChIKey | NUQVJBXLYJELHJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|