C8H17F2NO — CID 103759797
N-ethyl-1,1-difluoro-3-propoxypropan-2-amine (PubChem CID 103759797) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is N-ethyl-1,1-difluoro-3-propoxypropan-2-amine.
| Compound Name | N-ethyl-1,1-difluoro-3-propoxypropan-2-amine |
|---|---|
| PubChem CID | 103759797 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-ethyl-1,1-difluoro-3-propoxypropan-2-amine |
| SMILES | CCCOCC(NCC)C(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-3-5-12-6-7(8(9)10)11-4-2/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | PRCKPVHBEXXGMX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|