C6H14F2N2O — CID 105264981
(1,1-difluoro-3-propoxypropan-2-yl)hydrazine (PubChem CID 105264981) has the molecular formula C6H14F2N2O and a molecular weight of 168.19 g/mol. Its IUPAC name is (1,1-difluoro-3-propoxypropan-2-yl)hydrazine.
| Compound Name | (1,1-difluoro-3-propoxypropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105264981 |
| Molecular Formula | C6H14F2N2O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | (1,1-difluoro-3-propoxypropan-2-yl)hydrazine |
| SMILES | CCCOCC(NN)C(F)F |
| InChI | InChI=1S/C6H14F2N2O/c1-2-3-11-4-5(10-9)6(7)8/h5-6,10H,2-4,9H2,1H3 |
| InChIKey | SCDASLIGOGPZBG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|