About N-ethyl-1,1-difluoropentan-2-amine
N-ethyl-1,1-difluoropentan-2-amine (PubChem CID 80604281) has the molecular formula C7H15F2N
and a molecular weight of 151.20 g/mol. Its IUPAC name is N-ethyl-1,1-difluoropentan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1-difluoropentan-2-amine |
| PubChem CID | 80604281 |
| Molecular Formula | C7H15F2N |
| Molecular Weight | 151.20 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | N-ethyl-1,1-difluoropentan-2-amine |
| SMILES | CCCC(NCC)C(F)F |
| InChI | InChI=1S/C7H15F2N/c1-3-5-6(7(8)9)10-4-2/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | AEHZABYSHGNXPW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-1,1-difluoropentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-difluoropentan-2-amine?
The IUPAC name of N-ethyl-1,1-difluoropentan-2-amine (CID 80604281) is N-ethyl-1,1-difluoropentan-2-amine.
What is the SMILES notation for N-ethyl-1,1-difluoropentan-2-amine?
The canonical SMILES for N-ethyl-1,1-difluoropentan-2-amine is CCCC(NCC)C(F)F.
What is the InChIKey of N-ethyl-1,1-difluoropentan-2-amine?
The InChIKey is AEHZABYSHGNXPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2N/c1-3-5-6(7(8)9)10-4-2/h6-7,10H,3-5H2,1-2H3.
What are the key properties of N-ethyl-1,1-difluoropentan-2-amine?
N-ethyl-1,1-difluoropentan-2-amine has a molecular weight of 151.20 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-difluoropentan-2-amine is sourced from PubChem (CID 80604281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).