C14H31N — CID 115845744
N-ethyl-2,3,6-trimethylnonan-4-amine (PubChem CID 115845744) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is N-ethyl-2,3,6-trimethylnonan-4-amine.
| Compound Name | N-ethyl-2,3,6-trimethylnonan-4-amine |
|---|---|
| PubChem CID | 115845744 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | N-ethyl-2,3,6-trimethylnonan-4-amine |
| SMILES | CCCC(C)CC(NCC)C(C)C(C)C |
| InChI | InChI=1S/C14H31N/c1-7-9-12(5)10-14(15-8-2)13(6)11(3)4/h11-15H,7-10H2,1-6H3 |
| InChIKey | ZAKWSDVYXSSUAC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |