C15H33NO — CID 116721431
3-ethoxy-N-ethyl-2,6-dimethylnonan-4-amine (PubChem CID 116721431) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-2,6-dimethylnonan-4-amine.
| Compound Name | 3-ethoxy-N-ethyl-2,6-dimethylnonan-4-amine |
|---|---|
| PubChem CID | 116721431 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 3-ethoxy-N-ethyl-2,6-dimethylnonan-4-amine |
| SMILES | CCCC(C)CC(NCC)C(OCC)C(C)C |
| InChI | InChI=1S/C15H33NO/c1-7-10-13(6)11-14(16-8-2)15(12(4)5)17-9-3/h12-16H,7-11H2,1-6H3 |
| InChIKey | FGPIMKOLQSPDEF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |