C12H25NO — CID 116721344
4-ethoxy-N-ethyl-2,5-dimethylhex-1-en-3-amine (PubChem CID 116721344) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-2,5-dimethylhex-1-en-3-amine.
| Compound Name | 4-ethoxy-N-ethyl-2,5-dimethylhex-1-en-3-amine |
|---|---|
| PubChem CID | 116721344 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-ethoxy-N-ethyl-2,5-dimethylhex-1-en-3-amine |
| SMILES | C=C(C)C(NCC)C(OCC)C(C)C |
| InChI | InChI=1S/C12H25NO/c1-7-13-11(9(3)4)12(10(5)6)14-8-2/h10-13H,3,7-8H2,1-2,4-6H3 |
| InChIKey | UOWGHAUIDLUJOA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|