C13H27NO — CID 116721212
3-ethoxy-N,2-dimethyl-6-methylideneoctan-4-amine (PubChem CID 116721212) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-ethoxy-N,2-dimethyl-6-methylideneoctan-4-amine.
| Compound Name | 3-ethoxy-N,2-dimethyl-6-methylideneoctan-4-amine |
|---|---|
| PubChem CID | 116721212 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-ethoxy-N,2-dimethyl-6-methylideneoctan-4-amine |
| SMILES | C=C(CC)CC(NC)C(OCC)C(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-11(5)9-12(14-6)13(10(3)4)15-8-2/h10,12-14H,5,7-9H2,1-4,6H3 |
| InChIKey | XULHTPZACIDRKD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|