C10H21NO — CID 116721057
4-ethoxy-N,5-dimethylhex-1-en-3-amine (PubChem CID 116721057) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 4-ethoxy-N,5-dimethylhex-1-en-3-amine.
| Compound Name | 4-ethoxy-N,5-dimethylhex-1-en-3-amine |
|---|---|
| PubChem CID | 116721057 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 4-ethoxy-N,5-dimethylhex-1-en-3-amine |
| SMILES | C=CC(NC)C(OCC)C(C)C |
| InChI | InChI=1S/C10H21NO/c1-6-9(11-5)10(8(3)4)12-7-2/h6,8-11H,1,7H2,2-5H3 |
| InChIKey | JPXJFDOMFKIAMK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|