C9H19NO — CID 116719913
4-methoxy-N,5-dimethylhex-1-en-3-amine (PubChem CID 116719913) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 4-methoxy-N,5-dimethylhex-1-en-3-amine.
| Compound Name | 4-methoxy-N,5-dimethylhex-1-en-3-amine |
|---|---|
| PubChem CID | 116719913 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 4-methoxy-N,5-dimethylhex-1-en-3-amine |
| SMILES | C=CC(NC)C(OC)C(C)C |
| InChI | InChI=1S/C9H19NO/c1-6-8(10-4)9(11-5)7(2)3/h6-10H,1H2,2-5H3 |
| InChIKey | VZHREJRPOSYJHB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|