About N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide
N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 103761880) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
Molecular Properties
| Compound Name | N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| PubChem CID | 103761880 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C(NCc1cnc[nH]1)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C13H17N3O/c17-13(15-5-9-4-14-6-16-9)12-10-7-1-2-8(3-7)11(10)12/h4,6-8,10-12H,1-3,5H2,(H,14,16)(H,15,17) |
| InChIKey | BAIOEBQNWNGEOG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The IUPAC name of N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (CID 103761880) is N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
What is the SMILES notation for N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The canonical SMILES for N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide is O=C(NCc1cnc[nH]1)C1C2C3CCC(C3)C12.
What is the InChIKey of N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
The InChIKey is BAIOEBQNWNGEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c17-13(15-5-9-4-14-6-16-9)12-10-7-1-2-8(3-7)11(10)12/h4,6-8,10-12H,1-3,5H2,(H,14,16)(H,15,17).
What are the key properties of N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide?
N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide has a molecular weight of 231.30 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-5-ylmethyl)tricyclo[3.2.1.02,4]octane-3-carboxamide is sourced from PubChem (CID 103761880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).