C11H19F3N2O — CID 103764920
1-[(1-ethylcyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 103764920) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-[(1-ethylcyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1-ethylcyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 103764920 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[(1-ethylcyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCC1(CNC(=O)NCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-2-10(5-3-4-6-10)7-15-9(17)16-8-11(12,13)14/h2-8H2,1H3,(H2,15,16,17) |
| InChIKey | ZBBUYIBADRYXGY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |