C11H11F3N4O2 — CID 103766928
2-[2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]ethoxy]acetamide (PubChem CID 103766928) has the molecular formula C11H11F3N4O2 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2-[2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]ethoxy]acetamide.
| Compound Name | 2-[2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 103766928 |
| Molecular Formula | C11H11F3N4O2 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]ethoxy]acetamide |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1NCCOCC(N)=O |
| InChI | InChI=1S/C11H11F3N4O2/c12-11(13,14)8-2-1-7(5-15)10(18-8)17-3-4-20-6-9(16)19/h1-2H,3-4,6H2,(H2,16,19)(H,17,18) |
| InChIKey | YNCRJUSXOJWYLW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|