C15H16ClNO2 — CID 103767220
3-chloro-4-hydroxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide (PubChem CID 103767220) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
|---|---|
| PubChem CID | 103767220 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-chloro-4-hydroxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
| SMILES | O=C(NC1C2C3CCC(C3)C12)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClNO2/c16-10-6-9(3-4-11(10)18)15(19)17-14-12-7-1-2-8(5-7)13(12)14/h3-4,6-8,12-14,18H,1-2,5H2,(H,17,19) |
| InChIKey | XTLHTYNZZSFOLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |